FAD1018 W5-W6 — Phase Equilibria
Weeks 5–6 lectures covering phase equilibria, colligative properties, Raoult's law, and fractional distillation. Source files: W5 (1).pdf, W5 (2).pdf, W6 (1).pdf.
Lecturer: Puan Zuraini Kadir (zuraini81@um.edu.my)
References:
- Chemistry, R. Chang
- Comprehensive College Chemistry
- Principles of Chemistry, Tro
Summary
Three lectures on phase equilibria: (1) phase definitions, colligative properties, and one-component phase diagrams; (2) ideal/non-ideal solutions and Raoult's law; (3) fractional distillation and azeotropes.
Learning Outcomes
- Define phase and component
- Define colligative properties
- Perform calculations on colligative properties
- Define triple point and critical point for single-component systems
- Sketch phase diagrams of compounds similar to H₂O and CO₂
- Describe phase changes with respect to temperature and pressure
- State properties of ideal and non-ideal solutions for two-component systems
- Define and apply Raoult's law
- Define azeotrope
- Determine composition of an azeotropic mixture
- Sketch phase diagrams for two-component systems: ideal, positive deviation, and negative deviation from Raoult's law
- Explain principles involved in fractional distillation
- Determine residue and distillate from boiling point–composition phase diagrams
Lecture 1 — Phase, Components & Colligative Properties (W5)
Phase & Component Definitions
- Phase: A homogeneous part of a system separated by distinct physical boundaries (solid, liquid, gas).
- Component: A chemically independent constituent of a system.
| System | Phase | Component | Description |
|---|---|---|---|
| Mixture of O₂, N₂, H₂ gases | 1 | 3 | Gases well mixed; no visible boundary |
| Oil + water (unmixed) | 2 | 2 | Boundary between two liquids |
| Alcohol + water (mixed) | 1 | 2 | No boundary; miscible |
| Salt solution | 1 | 2 | Salt + water |
| Saturated CuSO₄ in closed bottle | 3 | 2 | Solid, liquid, gas (water vapour) |
| Steel | 1 | 2 | Fe + C |
O=O
N#N
[H][H]
[Na+].[Cl-]
[Cu+2].[O-]S([O-])(=O)=O
Types of Phase Changes
graph LR
S[Solid] -->|Fusion| L[Liquid]
L -->|Freezing| S
L -->|Vaporization| G[Gas]
G -->|Condensation| L
S -->|Sublimation| G
G -->|Deposition| S
Colligative Properties
Properties that depend on solute particle concentration, not identity:
- Freezing point depression: $ΔT_f = K_f m$
- Boiling point elevation: $ΔT_b = K_b m$
- Vapor pressure lowering: $ΔP = X_2 P_1^o$
- Osmotic pressure: $Π = MRT$
Where:
- $K_f$ = freezing-point depression constant
- $K_b$ = boiling point elevation constant
- $m$ = molality (mol solute / kg solvent)
- $M$ = molarity (mol / L)
- $X$ = mole fraction
- $R$ = 0.0821 L atm mol⁻¹ K⁻¹
Vapor Pressure Lowering (Raoult's Law)
Partial pressure of solvent over solution: $$P_A = X_A P_A^o$$
For 2-component system: $$X_A + X_B = 1$$ $$P_A = (1 - X_B) P_A^o$$ $$ΔP = P_A^o - P_A = X_B P_A^o$$
[!example] Example: Glucose solution 218 g glucose (RMM = 180.2) dissolved in 460 mL water at 30°C. $P_{water}^o = 31.82$ mmHg.
$n_{water} = 460 / 18 = 25.5$ mol $n_{glucose} = 218 / 180.2 = 1.21$ mol $X_{glucose} = 1.21 / (25.5 + 1.21) = 0.0453$ $ΔP = 0.0453 × 31.82 = 1.44$ mmHg New vapor pressure = $31.82 - 1.44 = 30.38$ mmHg
C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)O)O
Freezing Point Depression
$$ΔT_f = K_f m = T_{solution} - T_{solvent}$$
[!example] Example: Naphthalene in benzene 1.60 g naphthalene (C₁₀H₈) in 20.0 g benzene. $K_f$ (benzene) = 4.3 °C m⁻¹. Pure benzene fp = 5.5°C.
Molar mass naphthalene = 128.17 g/mol $m = (1.60 / 128.17) / 0.0200 = 0.624$ mol/kg $ΔT_f = 4.3 × 0.624 = 2.68$°C Freezing point = $5.5 - 2.68 = 2.82$°C
c1ccc2ccccc2c1
c1ccccc1
Boiling Point Elevation
$$ΔT_b = K_b m = T_{b,solution} - T_{b,solvent}$$
[!example] Example: Ethylene glycol as antifreeze 651 g EG in 2505 g water. RMM EG = 62. $K_f = 1.86$ °C/m, $K_b = 0.52$ °C/m.
$n_{EG} = 651 / 62 = 10.5$ mol $m = 10.5 / 2.505 = 4.19$ mol/kg $ΔT_f = 1.86 × 4.19 = 7.79$°C → fp = $-7.79$°C $ΔT_b = 0.52 × 4.19 = 2.18$°C → bp = $102.18$°C
OCCO
Osmotic Pressure
$$ΠV = nRT \quad \text{or} \quad Π = MRT$$
[!example] Example: Glycerin solution 46.0 g glycerin (C₃H₈O₃) per liter at 0°C. RMM = 92.
$n = 46 / 92 = 0.5$ mol $Π = (0.5 / 1.0) × 0.0821 × 273 = 11.21$ atm
OCC(O)CO
[!example] Example: Polystyrene molecular weight 5.0 g polystyrene/L, $Π = 0.0100$ atm at 25°C.
$n = ΠV / RT = (0.0100 × 1) / (0.0821 × 298) = 4.09 × 10^{-4}$ mol $M = 5.0 / 4.09 × 10^{-4} = 1.22 × 10^4$ g/mol
C=CC1=CC=CC=C1
One-Component Phase Diagrams
Water:
- Triple point: 0.01°C, 0.006 atm
- Critical point: 374°C, 218 atm
- Normal bp: 100°C (1 atm)
- Normal fp: 0°C (1 atm)
- Solid-liquid line has negative slope (ice less dense than water)
Carbon Dioxide:
- Triple point: −56.6°C, 5.11 atm
- Critical point: 31.1°C, 73 atm
- Sublimes at 1 atm (dry ice)
- Solid-liquid line has positive slope (solid denser than liquid)
O
O=C=O
Lecture 2 — Solutions & Raoult's Law (W5)
Molecular View of Solution Process
- Break A–A and B–B interactions (requires energy, $E_1$)
- Form A–B interactions (releases energy, $E_2$)
- $ΔH_{solution} = E_1 - E_2$
Types of Solutions
| Type | Condition | $ΔH_{soln}$ | $ΔV$ | Example |
|---|---|---|---|---|
| Ideal | A–A ≈ B–B ≈ A–B | 0 | 0 | Benzene–toluene |
| Positive deviation | A–A, B–B > A–B | +ve (endothermic) | +ve | Ethanol–water |
| Negative deviation | A–B > A–A, B–B | −ve (exothermic) | −ve | HCl–water |
c1ccccc1
Cc1ccccc1
CCO
O
Cl
Raoult's Law
For a two-component miscible liquid mixture:
$$P_A = X_A P_A^o$$ $$P_B = X_B P_B^o$$
By Dalton's law: $$P_{total} = P_A + P_B = X_A P_A^o + X_B P_B^o$$
Where $X_A + X_B = 1$.
- Ideal solution: obeys Raoult's law exactly ($P_1 = X_1 P_1^o$)
- Positive deviation: $P_{actual} > P_{calculated}$
- Negative deviation: $P_{actual} < P_{calculated}$
[!example] Example: Raoult's law verification Pure A: 60 kPa; Pure B: 30 kPa. Mixture: $X_A = 0.3$, $X_B = 0.7$, $P_{total} = 39$ kPa.
$P_{total,calc} = 0.3(60) + 0.7(30) = 18 + 21 = 39$ kPa Therefore, the mixture obeys Raoult's law (ideal).
[!example] Example: CS₂–acetone mixture 3.95 g CS₂ + 2.43 g acetone at 35°C. $P°_{CS₂} = 515$ torr, $P°_{acetone} = 332$ torr. Molar masses: CS₂ = 76.15, acetone = 58.0 g/mol.
$n_{CS₂} = 3.95 / 76.15 = 0.0519$ mol $n_{acetone} = 2.43 / 58.0 = 0.0419$ mol $X_{CS₂} = 0.0519 / (0.0519 + 0.0419) = 0.553$ $X_{acetone} = 0.447$ $P_{CS₂} = 0.553 × 515 = 285$ torr $P_{acetone} = 0.447 × 332 = 148$ torr $P_{total} = 285 + 148 = 433$ torr
C(=S)=S
CC(=O)C
[!example] Example: Sucrose solution vapor pressure 99.5 g sucrose + 300.0 mL water at 25°C. $P°_{water} = 23.8$ torr.
$n_{sucrose} = 99.5 / 342.3 = 0.291$ mol $n_{water} = 300 / 18 = 16.67$ mol $X_{water} = 16.67 / (16.67 + 0.291) = 0.983$ $P_{solution} = 0.983 × 23.8 = 23.4$ torr
C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@]2([C@H]([C@@H]([C@H](O2)CO)O)O)CO)O)O)O)O
Lecture 3 — Fractional Distillation & Azeotropes (W6)
Fractional Distillation
A procedure for separating liquid components based on different boiling points.
At the end of distillation:
- Liquid with lower boiling point → collected in receiving flask (distillate)
- Liquid with higher boiling point → left in distilling flask (residue)
Phase Diagram: Boiling Point vs Composition
For an ideal solution A–B:
- Upper curve: vapor composition
- Lower curve: liquid composition
- Region between curves: liquid + vapor coexistence
Azeotrope
A mixture that distills at constant composition (cannot be separated by simple fractional distillation).
Positive Deviation Azeotropes
- Azeotrope has minimum boiling point and maximum vapor pressure
- Boiling point of mixture lower than either pure component
Ethanol–Benzene system:
- Azeotrope: 32.4% ethanol
- Starting < 32.4% ethanol → distillate = azeotrope, residue = benzene
- Starting > 32.4% ethanol → distillate = azeotrope, residue = ethanol
- Starting = azeotrope → only azeotrope distills over
Ethanol–Water system:
- Azeotrope: 95.6% ethanol + 4.4% water
- Bp = 78.2°C (lower than pure ethanol 78.4°C and water 100°C)
CCO
c1ccccc1
[!note] Characteristics of positive deviation
- $P_{total} > P_{theoretical}$
- Endothermic solution ($ΔH = +ve$)
- $ΔV = +ve$ (expansion)
- $T_{b,A-B} > T_{b,A}$ or $T_{b,B}$ — correction: actually $T_{b,azeotrope} < T_{b,pure}$
Negative Deviation Azeotropes
- Azeotrope has maximum boiling point and minimum vapor pressure
- Boiling point of mixture higher than either pure component
HCl–Water system:
- Azeotrope: 20.2% HCl
- Starting < 20.2% HCl → distillate = pure H₂O, residue = azeotrope
- Starting > 20.2% HCl → distillate = pure HCl, residue = azeotrope
Nitric Acid–Water system:
- Azeotrope: 68% HNO₃ + 32% water
- Bp = 120.5°C (higher than pure HNO₃ 78°C and water 100°C)
Cl
O
O=[N+]([O-])O
[!note] Characteristics of negative deviation
- $P_{total} < P_{theoretical}$
- Exothermic solution ($ΔH = -ve$)
- $ΔV = -ve$ (shrinkage)
Key Distillation Rules
| Deviation | Starting Composition | Distillate | Residue |
|---|---|---|---|
| Positive | < azeotrope % | Azeotrope | Higher bp component |
| Positive | > azeotrope % | Azeotrope | Higher bp component |
| Negative | < azeotrope % | Lower bp pure component | Azeotrope |
| Negative | > azeotrope % | Higher bp pure component | Azeotrope |
Key Equations
| Property | Equation |
|---|---|
| Gibbs Phase Rule | $F = C - P + 2$ |
| Raoult's Law | $P_A = X_A P_A^o$ |
| Dalton's Law | $P_{total} = P_A + P_B$ |
| Vapor pressure lowering | $ΔP = X_{solute} P°_{solvent}$ |
| Boiling point elevation | $ΔT_b = K_b m$ |
| Freezing point depression | $ΔT_f = K_f m$ |
| Osmotic pressure | $Π = MRT$ |
| Clausius-Clapeyron | $\ln\frac{P_2}{P_1} = -\frac{ΔH_{vap}}{R}(\frac{1}{T_2} - \frac{1}{T_1})$ |
Related Topics
- Phase Equilibria
- Phase Diagrams
- Raoult's Law
- Colligative Properties
- Chemical Equilibrium
- Thermochemistry
- FAD1018 - Basic Chemistry II
Study Notes
[!note] Exam weightage Phase Equilibria appears in most papers with ~5–8% mark weight. Focus on:
- Raoult's Law calculations (vapor pressure, mole fraction)
- Colligative property calculations ($ΔT_b$, $ΔT_f$, $Π$)
- Drawing and interpreting phase diagrams
- Fractional distillation predictions from bp-composition diagrams
- Identifying azeotrope composition and behavior
[!warning] Common errors
- Confusing positive vs negative deviation characteristics
- Forgetting that azeotropes in positive deviation have minimum bp
- Mixing up distillate vs residue for non-ideal solutions
- Using molarity instead of molality for colligative properties